C14H19FO4 — CID 57406556
dimethyl 5-fluoroadamantane-1,3-dicarboxylate (PubChem CID 57406556) has the molecular formula C14H19FO4 and a molecular weight of 270.30 g/mol. Its IUPAC name is dimethyl 5-fluoroadamantane-1,3-dicarboxylate.
| Compound Name | dimethyl 5-fluoroadamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 57406556 |
| Molecular Formula | C14H19FO4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | dimethyl 5-fluoroadamantane-1,3-dicarboxylate |
| SMILES | COC(=O)C12CC3CC(F)(C1)CC(C(=O)OC)(C3)C2 |
| InChI | InChI=1S/C14H19FO4/c1-18-10(16)12-3-9-4-13(6-12,11(17)19-2)8-14(15,5-9)7-12/h9H,3-8H2,1-2H3 |
| InChIKey | MQTRJNCZZXBWDM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |