C16H18N2O2 — CID 123586218
(3-cyano-5-isocyano-1-adamantyl) 2-methylprop-2-enoate (PubChem CID 123586218) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (3-cyano-5-isocyano-1-adamantyl) 2-methylprop-2-enoate.
| Compound Name | (3-cyano-5-isocyano-1-adamantyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123586218 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3-cyano-5-isocyano-1-adamantyl) 2-methylprop-2-enoate |
| SMILES | [C-]#[N+]C12CC3CC(C#N)(C1)CC(OC(=O)C(=C)C)(C3)C2 |
| InChI | InChI=1S/C16H18N2O2/c1-11(2)13(19)20-16-6-12-4-14(8-16,10-17)7-15(5-12,9-16)18-3/h12H,1,4-9H2,2H3 |
| InChIKey | IPTKQHKFCXZDPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|