C18H25NO2 — CID 140644648
methyl (E)-3-(3-cyano-5,7-dimethyl-1-adamantyl)-2-methylprop-2-enoate (PubChem CID 140644648) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is methyl (E)-3-(3-cyano-5,7-dimethyl-1-adamantyl)-2-methylprop-2-enoate.
| Compound Name | methyl (E)-3-(3-cyano-5,7-dimethyl-1-adamantyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140644648 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | methyl (E)-3-(3-cyano-5,7-dimethyl-1-adamantyl)-2-methylprop-2-enoate |
| SMILES | COC(=O)/C(C)=C/C12CC3(C)CC(C)(CC(C#N)(C3)C1)C2 |
| InChI | InChI=1S/C18H25NO2/c1-13(14(20)21-4)5-17-7-15(2)6-16(3,8-17)10-18(9-15,11-17)12-19/h5H,6-11H2,1-4H3/b13-5+ |
| InChIKey | UKVMXYMOPGGATI-WLRTZDKTSA-N |
| XLogP | 4.00 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|