C18H29NO2 — CID 103256597
methyl 4-[(3,5-dimethyl-1-adamantyl)amino]-2-methylbut-2-enoate (PubChem CID 103256597) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is methyl 4-[(3,5-dimethyl-1-adamantyl)amino]-2-methylbut-2-enoate.
| Compound Name | methyl 4-[(3,5-dimethyl-1-adamantyl)amino]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 103256597 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | methyl 4-[(3,5-dimethyl-1-adamantyl)amino]-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCNC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H29NO2/c1-13(15(20)21-4)5-6-19-18-9-14-7-16(2,11-18)10-17(3,8-14)12-18/h5,14,19H,6-12H2,1-4H3 |
| InChIKey | KWANIQSJGQWNJP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|