About 1,4-dibromoadamantane
1,4-dibromoadamantane (PubChem CID 4533350) has the molecular formula C10H14Br2
and a molecular weight of 294.03 g/mol. Its IUPAC name is 1,4-dibromoadamantane.
Molecular Properties
| Compound Name | 1,4-dibromoadamantane |
| PubChem CID | 4533350 |
| Molecular Formula | C10H14Br2 |
| Molecular Weight | 294.03 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | 1,4-dibromoadamantane |
| SMILES | BrC1C2CC3CC1CC(Br)(C3)C2 |
| InChI | InChI=1S/C10H14Br2/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-9H,1-5H2 |
| InChIKey | BPJZBMGMBABTDL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.03 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromoadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromoadamantane?
The IUPAC name of 1,4-dibromoadamantane (CID 4533350) is 1,4-dibromoadamantane.
What is the SMILES notation for 1,4-dibromoadamantane?
The canonical SMILES for 1,4-dibromoadamantane is BrC1C2CC3CC1CC(Br)(C3)C2.
What is the InChIKey of 1,4-dibromoadamantane?
The InChIKey is BPJZBMGMBABTDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Br2/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-9H,1-5H2.
What are the key properties of 1,4-dibromoadamantane?
1,4-dibromoadamantane has a molecular weight of 294.03 g/mol, XLogP of 3.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromoadamantane is sourced from PubChem (CID 4533350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).