C28H44Br2 — CID 102020002
(1S,3R,5S,7S)-1-bromo-3-[(1R,3S,5S,7S)-3-bromo-5-tert-butyl-1-adamantyl]-5-tert-butyladamantane (PubChem CID 102020002) has the molecular formula C28H44Br2 and a molecular weight of 540.47 g/mol. Its IUPAC name is (1S,3R,5S,7S)-1-bromo-3-[(1R,3S,5S,7S)-3-bromo-5-tert-butyl-1-adamantyl]-5-tert-butyladamantane.
| Compound Name | (1S,3R,5S,7S)-1-bromo-3-[(1R,3S,5S,7S)-3-bromo-5-tert-butyl-1-adamantyl]-5-tert-butyladamantane |
|---|---|
| PubChem CID | 102020002 |
| Molecular Formula | C28H44Br2 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | (1S,3R,5S,7S)-1-bromo-3-[(1R,3S,5S,7S)-3-bromo-5-tert-butyl-1-adamantyl]-5-tert-butyladamantane |
| SMILES | CC(C)(C)[C@]12C[C@@H]3C[C@](Br)(C1)C[C@@]([C@]14C[C@H]5C[C@](Br)(C[C@](C(C)(C)C)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C28H44Br2/c1-21(2,3)23-7-19-9-25(13-23,17-27(29,11-19)15-23)26-10-20-8-24(14-26,22(4,5)6)16-28(30,12-20)18-26/h19-20H,7-18H2,1-6H3/t19-,20-,23-,24-,25+,26+,27-,28-/m0/s1 |
| InChIKey | XLOGDHXHPPZCNV-RQQVWRPLSA-N |
| XLogP | 9.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|