C12H19Br — CID 1268039
(3R,5S)-1-bromo-3,5-dimethyladamantane (PubChem CID 1268039) has the molecular formula C12H19Br and a molecular weight of 243.19 g/mol. Its IUPAC name is (3R,5S)-1-bromo-3,5-dimethyladamantane.
| Compound Name | (3R,5S)-1-bromo-3,5-dimethyladamantane |
|---|---|
| PubChem CID | 1268039 |
| Molecular Formula | C12H19Br |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (3R,5S)-1-bromo-3,5-dimethyladamantane |
| SMILES | C[C@]12CC3CC(Br)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C12H19Br/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3/t9?,10-,11+,12? |
| InChIKey | QUCXLVDIVQWYJR-WSVSKBAQSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|