C18H30Br2 — CID 101218879
1,3-dibromo-5,7-dibutyladamantane (PubChem CID 101218879) has the molecular formula C18H30Br2 and a molecular weight of 406.25 g/mol. Its IUPAC name is 1,3-dibromo-5,7-dibutyladamantane.
| Compound Name | 1,3-dibromo-5,7-dibutyladamantane |
|---|---|
| PubChem CID | 101218879 |
| Molecular Formula | C18H30Br2 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1,3-dibromo-5,7-dibutyladamantane |
| SMILES | CCCCC12CC3(Br)CC(Br)(C1)CC(CCCC)(C3)C2 |
| InChI | InChI=1S/C18H30Br2/c1-3-5-7-15-9-16(8-6-4-2)12-17(19,10-15)14-18(20,11-15)13-16/h3-14H2,1-2H3 |
| InChIKey | VTIVURYAGRPTBB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|