About 1,3-dibromo-5,7-dibutyladamantane
1,3-dibromo-5,7-dibutyladamantane (PubChem CID 101218879) has the molecular formula C18H30Br2
and a molecular weight of 406.25 g/mol. Its IUPAC name is 1,3-dibromo-5,7-dibutyladamantane.
Molecular Properties
| Compound Name | 1,3-dibromo-5,7-dibutyladamantane |
| PubChem CID | 101218879 |
| Molecular Formula | C18H30Br2 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1,3-dibromo-5,7-dibutyladamantane |
| SMILES | CCCCC12CC3(Br)CC(Br)(C1)CC(CCCC)(C3)C2 |
| InChI | InChI=1S/C18H30Br2/c1-3-5-7-15-9-16(8-6-4-2)12-17(19,10-15)14-18(20,11-15)13-16/h3-14H2,1-2H3 |
| InChIKey | VTIVURYAGRPTBB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromo-5,7-dibutyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-5,7-dibutyladamantane?
The IUPAC name of 1,3-dibromo-5,7-dibutyladamantane (CID 101218879) is 1,3-dibromo-5,7-dibutyladamantane.
What is the SMILES notation for 1,3-dibromo-5,7-dibutyladamantane?
The canonical SMILES for 1,3-dibromo-5,7-dibutyladamantane is CCCCC12CC3(Br)CC(Br)(C1)CC(CCCC)(C3)C2.
What is the InChIKey of 1,3-dibromo-5,7-dibutyladamantane?
The InChIKey is VTIVURYAGRPTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30Br2/c1-3-5-7-15-9-16(8-6-4-2)12-17(19,10-15)14-18(20,11-15)13-16/h3-14H2,1-2H3.
What are the key properties of 1,3-dibromo-5,7-dibutyladamantane?
1,3-dibromo-5,7-dibutyladamantane has a molecular weight of 406.25 g/mol, XLogP of 6.99, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-5,7-dibutyladamantane is sourced from PubChem (CID 101218879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).