C10H12Br4 — CID 632907
1,3,5,7-tetrabromoadamantane (PubChem CID 632907) has the molecular formula C10H12Br4 and a molecular weight of 451.82 g/mol. Its IUPAC name is 1,3,5,7-tetrabromoadamantane.
| Compound Name | 1,3,5,7-tetrabromoadamantane |
|---|---|
| PubChem CID | 632907 |
| Molecular Formula | C10H12Br4 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 447.77 |
| IUPAC Name | 1,3,5,7-tetrabromoadamantane |
| SMILES | BrC12CC3(Br)CC(Br)(C1)CC(Br)(C2)C3 |
| InChI | InChI=1S/C10H12Br4/c11-7-1-8(12)4-9(13,2-7)6-10(14,3-7)5-8/h1-6H2 |
| InChIKey | SWVWJFWKWBFPID-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|