C11H17BrN2 — CID 18373591
3-bromoadamantane-1-carboximidamide (PubChem CID 18373591) has the molecular formula C11H17BrN2 and a molecular weight of 257.17 g/mol. Its IUPAC name is 3-bromoadamantane-1-carboximidamide.
| Compound Name | 3-bromoadamantane-1-carboximidamide |
|---|---|
| PubChem CID | 18373591 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-bromoadamantane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C11H17BrN2/c12-11-4-7-1-8(5-11)3-10(2-7,6-11)9(13)14/h7-8H,1-6H2,(H3,13,14) |
| InChIKey | XQWJMQICAWMHBF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|