C17H22BrN2O3+ — CID 23309132
[(3R)-5-[(5S,7S)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium (PubChem CID 23309132) has the molecular formula C17H22BrN2O3+ and a molecular weight of 382.28 g/mol. Its IUPAC name is [(3R)-5-[(5S,7S)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium.
| Compound Name | [(3R)-5-[(5S,7S)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium |
|---|---|
| PubChem CID | 23309132 |
| Molecular Formula | C17H22BrN2O3+ |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [(3R)-5-[(5S,7S)-3-bromoadamantane-1-carbonyl]oxy-3-cyano-4-oxopent-1-en-2-yl]azanium |
| SMILES | C=C([NH3+])[C@H](C#N)C(=O)COC(=O)C12C[C@@H]3C[C@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C17H21BrN2O3/c1-10(20)13(7-19)14(21)8-23-15(22)16-3-11-2-12(4-16)6-17(18,5-11)9-16/h11-13H,1-6,8-9,20H2/p+1/t11-,12-,13-,16?,17?/m0/s1 |
| InChIKey | QKLUFKKJCZSWBF-WJKSHOGISA-O |
| XLogP | 1.73 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|