C20H26BrNO3 — CID 98306487
[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (5R,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 98306487) has the molecular formula C20H26BrNO3 and a molecular weight of 408.34 g/mol. Its IUPAC name is [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (5R,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98306487 |
| Molecular Formula | C20H26BrNO3 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)C23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)c(C)n1C |
| InChI | InChI=1S/C20H26BrNO3/c1-12-4-16(13(2)22(12)3)17(23)10-25-18(24)19-6-14-5-15(7-19)9-20(21,8-14)11-19/h4,14-15H,5-11H2,1-3H3/t14-,15-,19?,20?/m1/s1 |
| InChIKey | RLBZIAOBBRHRQD-SNEKZUEESA-N |
| XLogP | 4.10 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|