C27H37NO3 — CID 7873753
[2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 7873753) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 7873753 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)C23CC4CC(CC(C4)C2)C3)c(C)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C27H37NO3/c1-18-10-24(19(2)28(18)9-8-20-6-4-3-5-7-20)25(29)17-31-26(30)27-14-21-11-22(15-27)13-23(12-21)16-27/h6,10,21-23H,3-5,7-9,11-17H2,1-2H3 |
| InChIKey | FOSDNQBKWMWYMV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|