C27H34N2O6 — CID 42983651
[2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate (PubChem CID 42983651) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate.
| Compound Name | [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42983651 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCC(=O)c2cc(C)n(CCC3=CCCCC3)c2C)cc1OC |
| InChI | InChI=1S/C27H34N2O6/c1-18-14-22(19(2)29(18)13-12-20-8-6-5-7-9-20)23(30)17-35-26(31)16-28-27(32)21-10-11-24(33-3)25(15-21)34-4/h8,10-11,14-15H,5-7,9,12-13,16-17H2,1-4H3,(H,28,32) |
| InChIKey | BXDNMAJLLXWFND-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|