C24H30N2O6 — CID 4843185
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-[(3,4-diethoxybenzoyl)amino]acetate (PubChem CID 4843185) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-[(3,4-diethoxybenzoyl)amino]acetate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-[(3,4-diethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 4843185 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-[(3,4-diethoxybenzoyl)amino]acetate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)CNC(=O)c2ccc(OCC)c(OCC)c2)c1C |
| InChI | InChI=1S/C24H30N2O6/c1-6-11-26-16(4)12-19(17(26)5)20(27)15-32-23(28)14-25-24(29)18-9-10-21(30-7-2)22(13-18)31-8-3/h6,9-10,12-13H,1,7-8,11,14-15H2,2-5H3,(H,25,29) |
| InChIKey | IDXJJFIIBHJFTL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|