C23H27FN2O4 — CID 9492000
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 9492000) has the molecular formula C23H27FN2O4 and a molecular weight of 414.48 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 9492000 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)[C@@H](NC(=O)c2ccc(F)cc2)C(C)C)c1C |
| InChI | InChI=1S/C23H27FN2O4/c1-6-11-26-15(4)12-19(16(26)5)20(27)13-30-23(29)21(14(2)3)25-22(28)17-7-9-18(24)10-8-17/h6-10,12,14,21H,1,11,13H2,2-5H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | TZABTHZMLZIKPS-NRFANRHFSA-N |
| XLogP | 3.61 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|