C25H34N2O4 — CID 8888724
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] (2S)-2-(adamantane-1-carbonylamino)propanoate (PubChem CID 8888724) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] (2S)-2-(adamantane-1-carbonylamino)propanoate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] (2S)-2-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8888724 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] (2S)-2-(adamantane-1-carbonylamino)propanoate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)[C@H](C)NC(=O)C23CC4CC(CC(C4)C2)C3)c1C |
| InChI | InChI=1S/C25H34N2O4/c1-5-6-27-15(2)7-21(17(27)4)22(28)14-31-23(29)16(3)26-24(30)25-11-18-8-19(12-25)10-20(9-18)13-25/h5,7,16,18-20H,1,6,8-14H2,2-4H3,(H,26,30)/t16-,18?,19?,20?,25?/m0/s1 |
| InChIKey | PLPUVIIEZSUSKG-WEKSBHCLSA-N |
| XLogP | 3.74 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|