C22H26N2O4 — CID 7858940
1-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-(2-nitrophenoxy)ethanone (PubChem CID 7858940) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-(2-nitrophenoxy)ethanone.
| Compound Name | 1-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-(2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 7858940 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-(2-nitrophenoxy)ethanone |
| SMILES | Cc1cc(C(=O)COc2ccccc2[N+](=O)[O-])c(C)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C22H26N2O4/c1-16-14-19(17(2)23(16)13-12-18-8-4-3-5-9-18)21(25)15-28-22-11-7-6-10-20(22)24(26)27/h6-8,10-11,14H,3-5,9,12-13,15H2,1-2H3 |
| InChIKey | RKLFUNIEMBTTDC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|