C22H21FN2O4 — CID 7916464
1-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-(5-fluoro-2-nitrophenoxy)ethanone (PubChem CID 7916464) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-(5-fluoro-2-nitrophenoxy)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-(5-fluoro-2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 7916464 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1-[2,5-dimethyl-1-(2-phenylethyl)pyrrol-3-yl]-2-(5-fluoro-2-nitrophenoxy)ethanone |
| SMILES | Cc1cc(C(=O)COc2cc(F)ccc2[N+](=O)[O-])c(C)n1CCc1ccccc1 |
| InChI | InChI=1S/C22H21FN2O4/c1-15-12-19(16(2)24(15)11-10-17-6-4-3-5-7-17)21(26)14-29-22-13-18(23)8-9-20(22)25(27)28/h3-9,12-13H,10-11,14H2,1-2H3 |
| InChIKey | SPBSYXYJXOTXAL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|