C14H13FN2O4 — CID 31118152
1-(2,5-dimethyl-1H-pyrrol-3-yl)-2-(5-fluoro-2-nitrophenoxy)ethanone (PubChem CID 31118152) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1H-pyrrol-3-yl)-2-(5-fluoro-2-nitrophenoxy)ethanone.
| Compound Name | 1-(2,5-dimethyl-1H-pyrrol-3-yl)-2-(5-fluoro-2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 31118152 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(2,5-dimethyl-1H-pyrrol-3-yl)-2-(5-fluoro-2-nitrophenoxy)ethanone |
| SMILES | Cc1cc(C(=O)COc2cc(F)ccc2[N+](=O)[O-])c(C)[nH]1 |
| InChI | InChI=1S/C14H13FN2O4/c1-8-5-11(9(2)16-8)13(18)7-21-14-6-10(15)3-4-12(14)17(19)20/h3-6,16H,7H2,1-2H3 |
| InChIKey | OCQLHRKVCYJQDA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|