C22H29N3O7S — CID 4841764
1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone (PubChem CID 4841764) has the molecular formula C22H29N3O7S and a molecular weight of 479.56 g/mol. Its IUPAC name is 1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 4841764 |
| Molecular Formula | C22H29N3O7S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone |
| SMILES | COCCCn1c(C)cc(C(=O)COc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C22H29N3O7S/c1-16-13-19(17(2)24(16)11-6-12-31-3)21(26)15-32-22-8-7-18(14-20(22)25(27)28)33(29,30)23-9-4-5-10-23/h7-8,13-14H,4-6,9-12,15H2,1-3H3 |
| InChIKey | JDXJPKXHTVGEEX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 120.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|