C20H23N3O7S — CID 4033289
1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone (PubChem CID 4033289) has the molecular formula C20H23N3O7S and a molecular weight of 449.49 g/mol. Its IUPAC name is 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 4033289 |
| Molecular Formula | C20H23N3O7S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)COc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C20H23N3O7S/c1-12-19(14(3)24)13(2)21-20(12)17(25)11-30-18-7-6-15(10-16(18)23(26)27)31(28,29)22-8-4-5-9-22/h6-7,10,21H,4-5,8-9,11H2,1-3H3 |
| InChIKey | BSUOVGJYRNTLOU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|