C23H27NO5 — CID 7870750
[2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 7870750) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 7870750 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [2-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(O)cc2O)c(C)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C23H27NO5/c1-15-12-20(16(2)24(15)11-10-17-6-4-3-5-7-17)22(27)14-29-23(28)19-9-8-18(25)13-21(19)26/h6,8-9,12-13,25-26H,3-5,7,10-11,14H2,1-2H3 |
| InChIKey | GRUPLUKJALISOD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|