C19H22ClNO5 — CID 7500103
[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-chloro-2-hydroxybenzoate (PubChem CID 7500103) has the molecular formula C19H22ClNO5 and a molecular weight of 379.84 g/mol. Its IUPAC name is [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7500103 |
| Molecular Formula | C19H22ClNO5 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-chloro-2-hydroxybenzoate |
| SMILES | COCCCn1c(C)cc(C(=O)COC(=O)c2ccc(Cl)cc2O)c1C |
| InChI | InChI=1S/C19H22ClNO5/c1-12-9-16(13(2)21(12)7-4-8-25-3)18(23)11-26-19(24)15-6-5-14(20)10-17(15)22/h5-6,9-10,22H,4,7-8,11H2,1-3H3 |
| InChIKey | KREPEDDETFMPIC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|