C21H27NO5 — CID 55386078
[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(methoxymethyl)benzoate (PubChem CID 55386078) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(methoxymethyl)benzoate.
| Compound Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 55386078 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(methoxymethyl)benzoate |
| SMILES | COCCCn1c(C)cc(C(=O)COC(=O)c2cccc(COC)c2)c1C |
| InChI | InChI=1S/C21H27NO5/c1-15-11-19(16(2)22(15)9-6-10-25-3)20(23)14-27-21(24)18-8-5-7-17(12-18)13-26-4/h5,7-8,11-12H,6,9-10,13-14H2,1-4H3 |
| InChIKey | FKUAARHUBQFOND-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|