C23H25NO4 — CID 7698318
[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] naphthalene-2-carboxylate (PubChem CID 7698318) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] naphthalene-2-carboxylate.
| Compound Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7698318 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] naphthalene-2-carboxylate |
| SMILES | COCCCn1c(C)cc(C(=O)COC(=O)c2ccc3ccccc3c2)c1C |
| InChI | InChI=1S/C23H25NO4/c1-16-13-21(17(2)24(16)11-6-12-27-3)22(25)15-28-23(26)20-10-9-18-7-4-5-8-19(18)14-20/h4-5,7-10,13-14H,6,11-12,15H2,1-3H3 |
| InChIKey | TXYGMOIDWSRTOG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|