C22H25N3O6S2 — CID 55309593
[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55309593) has the molecular formula C22H25N3O6S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55309593 |
| Molecular Formula | C22H25N3O6S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | COCCCn1c(C)cc(C(=O)COC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)c1C |
| InChI | InChI=1S/C22H25N3O6S2/c1-14-11-17(15(2)24(14)7-4-9-30-3)19(26)13-31-21(27)16-5-6-18-20(12-16)32-22-23-33(28,29)10-8-25(18)22/h5-6,11-12H,4,7-10,13H2,1-3H3 |
| InChIKey | VOUKTZXURGXTID-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 107.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|