C20H18ClN3O6S2 — CID 55309667
[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55309667) has the molecular formula C20H18ClN3O6S2 and a molecular weight of 495.97 g/mol. Its IUPAC name is [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55309667 |
| Molecular Formula | C20H18ClN3O6S2 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)COC(=O)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C20H18ClN3O6S2/c1-11-7-14(16(29-2)9-13(11)21)22-18(25)10-30-19(26)12-3-4-15-17(8-12)31-20-23-32(27,28)6-5-24(15)20/h3-4,7-9H,5-6,10H2,1-2H3,(H,22,25) |
| InChIKey | LKGHIPQMIPOSRW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |