C18H19ClN2O7S — CID 42984985
[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 4-methoxy-3-sulfamoylbenzoate (PubChem CID 42984985) has the molecular formula C18H19ClN2O7S and a molecular weight of 442.88 g/mol. Its IUPAC name is [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 4-methoxy-3-sulfamoylbenzoate.
| Compound Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 4-methoxy-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42984985 |
| Molecular Formula | C18H19ClN2O7S |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 4-methoxy-3-sulfamoylbenzoate |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)COC(=O)c1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C18H19ClN2O7S/c1-10-6-13(15(27-3)8-12(10)19)21-17(22)9-28-18(23)11-4-5-14(26-2)16(7-11)29(20,24)25/h4-8H,9H2,1-3H3,(H,21,22)(H2,20,24,25) |
| InChIKey | XAEYXNPVVOYBAN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |