C19H17N3O7S3 — CID 55469320
[2-(4-methylsulfonylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55469320) has the molecular formula C19H17N3O7S3 and a molecular weight of 495.56 g/mol. Its IUPAC name is [2-(4-methylsulfonylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55469320 |
| Molecular Formula | C19H17N3O7S3 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)COC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)cc1 |
| InChI | InChI=1S/C19H17N3O7S3/c1-31(25,26)14-5-3-13(4-6-14)20-17(23)11-29-18(24)12-2-7-15-16(10-12)30-19-21-32(27,28)9-8-22(15)19/h2-7,10H,8-9,11H2,1H3,(H,20,23) |
| InChIKey | LMMBQHTYGHOFPI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |