C21H18N2O7S2 — CID 55400359
[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55400359) has the molecular formula C21H18N2O7S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55400359 |
| Molecular Formula | C21H18N2O7S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H18N2O7S2/c24-16(13-3-5-17-18(10-13)29-8-1-7-28-17)12-30-20(25)14-2-4-15-19(11-14)31-21-22-32(26,27)9-6-23(15)21/h2-5,10-11H,1,6-9,12H2 |
| InChIKey | MKJZBUGLMXMSKM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 111.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |