C19H18N2O7S — CID 55404113
[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 55404113) has the molecular formula C19H18N2O7S and a molecular weight of 418.43 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 55404113 |
| Molecular Formula | C19H18N2O7S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | O=C(OCC(=O)c1ccc2c(c1)OCCCO2)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C19H18N2O7S/c22-15(13-2-4-16-17(10-13)27-8-1-7-26-16)12-28-19(23)14-3-5-18-20-29(24,25)9-6-21(18)11-14/h2-5,10-11H,1,6-9,12H2 |
| InChIKey | RDQGPFAXRPWNQU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 111.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |