C20H19N3O9S — CID 55371156
dimethyl 5-[[2-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 55371156) has the molecular formula C20H19N3O9S and a molecular weight of 477.45 g/mol. Its IUPAC name is dimethyl 5-[[2-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55371156 |
| Molecular Formula | C20H19N3O9S |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | dimethyl 5-[[2-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H19N3O9S/c1-30-18(25)13-7-14(19(26)31-2)9-15(8-13)21-17(24)11-32-20(27)12-3-4-16-22-33(28,29)6-5-23(16)10-12/h3-4,7-10H,5-6,11H2,1-2H3,(H,21,24) |
| InChIKey | BREUVDASRVWTOJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|