C18H18N4O5S3 — CID 55586624
N-[[4-(methylsulfamoyl)phenyl]methyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 55586624) has the molecular formula C18H18N4O5S3 and a molecular weight of 466.57 g/mol. Its IUPAC name is N-[[4-(methylsulfamoyl)phenyl]methyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-[[4-(methylsulfamoyl)phenyl]methyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 55586624 |
| Molecular Formula | C18H18N4O5S3 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | N-[[4-(methylsulfamoyl)phenyl]methyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(CNC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)cc1 |
| InChI | InChI=1S/C18H18N4O5S3/c1-19-30(26,27)14-5-2-12(3-6-14)11-20-17(23)13-4-7-15-16(10-13)28-18-21-29(24,25)9-8-22(15)18/h2-7,10,19H,8-9,11H2,1H3,(H,20,23) |
| InChIKey | NDPVEARUHGIBLB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |