C23H30N2O5 — CID 46819802
[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-benzamidobutanoate (PubChem CID 46819802) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-benzamidobutanoate.
| Compound Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 46819802 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-benzamidobutanoate |
| SMILES | COCCCn1c(C)cc(C(=O)COC(=O)CC(C)NC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C23H30N2O5/c1-16(24-23(28)19-9-6-5-7-10-19)13-22(27)30-15-21(26)20-14-17(2)25(18(20)3)11-8-12-29-4/h5-7,9-10,14,16H,8,11-13,15H2,1-4H3,(H,24,28) |
| InChIKey | ADDWAPXUILKEKB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|