C21H25Cl2NO5 — CID 25499024
ethyl 3,5-dichloro-4-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]benzoate (PubChem CID 25499024) has the molecular formula C21H25Cl2NO5 and a molecular weight of 442.34 g/mol. Its IUPAC name is ethyl 3,5-dichloro-4-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]benzoate.
| Compound Name | ethyl 3,5-dichloro-4-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 25499024 |
| Molecular Formula | C21H25Cl2NO5 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | ethyl 3,5-dichloro-4-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(OCC(=O)c2cc(C)n(CCCOC)c2C)c(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2NO5/c1-5-28-21(26)15-10-17(22)20(18(23)11-15)29-12-19(25)16-9-13(2)24(14(16)3)7-6-8-27-4/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | OLNKUHBRHTVBRR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|