C24H29N3O5 — CID 55750703
ethyl 4-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-1-phenylpyrazole-3-carboxylate (PubChem CID 55750703) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is ethyl 4-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-1-phenylpyrazole-3-carboxylate.
| Compound Name | ethyl 4-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55750703 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | ethyl 4-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-1-phenylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)cc1OCC(=O)c1cc(C)n(CCCOC)c1C |
| InChI | InChI=1S/C24H29N3O5/c1-5-31-24(29)23-22(15-27(25-23)19-10-7-6-8-11-19)32-16-21(28)20-14-17(2)26(18(20)3)12-9-13-30-4/h6-8,10-11,14-15H,5,9,12-13,16H2,1-4H3 |
| InChIKey | JCFOQKVSTBAHLN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 84.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|