C17H21BrN2O3 — CID 7937014
(3-cyano-4-imino-2-oxopentyl) (5S,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 7937014) has the molecular formula C17H21BrN2O3 and a molecular weight of 381.27 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) (5S,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) (5S,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7937014 |
| Molecular Formula | C17H21BrN2O3 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) (5S,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C17H21BrN2O3/c1-10(20)13(7-19)14(21)8-23-15(22)16-3-11-2-12(4-16)6-17(18,5-11)9-16/h11-13,20H,2-6,8-9H2,1H3/b20-10+/t11-,12+,13?,16?,17? |
| InChIKey | XROUNJQYWFGCLX-ZZJSDWCLSA-N |
| XLogP | 3.01 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|