C14H20S — CID 102184392
(7S,11R)-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1-thiol (PubChem CID 102184392) has the molecular formula C14H20S and a molecular weight of 220.38 g/mol. Its IUPAC name is (7S,11R)-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1-thiol.
| Compound Name | (7S,11R)-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1-thiol |
|---|---|
| PubChem CID | 102184392 |
| Molecular Formula | C14H20S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (7S,11R)-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1-thiol |
| SMILES | SC12CC3C[C@@H]4C5CC(CC41)CC2[C@H]5C3 |
| InChI | InChI=1S/C14H20S/c15-14-6-8-2-10-9-1-7(4-12(10)14)5-13(14)11(9)3-8/h7-13,15H,1-6H2/t7?,8?,9?,10-,11+,12?,13?,14? |
| InChIKey | SAYHNLBKHGJWOO-FLDLDNQJSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|