C11H18O — CID 147477215
3-(ethoxymethyl)tricyclo[3.2.1.03,6]octane (PubChem CID 147477215) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 3-(ethoxymethyl)tricyclo[3.2.1.03,6]octane.
| Compound Name | 3-(ethoxymethyl)tricyclo[3.2.1.03,6]octane |
|---|---|
| PubChem CID | 147477215 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 3-(ethoxymethyl)tricyclo[3.2.1.03,6]octane |
| SMILES | CCOCC12CC3CC(C1)C2C3 |
| InChI | InChI=1S/C11H18O/c1-2-12-7-11-5-8-3-9(6-11)10(11)4-8/h8-10H,2-7H2,1H3 |
| InChIKey | FCXLKKOPIKBPSP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |