C13H10N4 — CID 23270799
spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,2,3,3-tetracarbonitrile (PubChem CID 23270799) has the molecular formula C13H10N4 and a molecular weight of 222.25 g/mol. Its IUPAC name is spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,2,3,3-tetracarbonitrile.
| Compound Name | spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 23270799 |
| Molecular Formula | C13H10N4 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,2,3,3-tetracarbonitrile |
| SMILES | N#CC1(C#N)C2CCC(C23CC3)C1(C#N)C#N |
| InChI | InChI=1S/C13H10N4/c14-5-12(6-15)9-1-2-10(11(9)3-4-11)13(12,7-16)8-17/h9-10H,1-4H2 |
| InChIKey | OPSRPHBIFJEZHD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|