About 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile
1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile (PubChem CID 543320) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile.
Analyze 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile?
The IUPAC name of 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile (CID 543320) is 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile.
What is the SMILES notation for 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile?
The canonical SMILES for 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile is CC1CCC2(C)C(C1)C2(C#N)C#N.
What is the InChIKey of 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile?
The InChIKey is SGVMKEWWZPDVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-8-3-4-10(2)9(5-8)11(10,6-12)7-13/h8-9H,3-5H2,1-2H3.
What are the key properties of 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile?
1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile has a molecular weight of 174.25 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylbicyclo[4.1.0]heptane-7,7-dicarbonitrile is sourced from PubChem (CID 543320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).