About cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile
cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile (PubChem CID 59970295) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile.
Analyze cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile?
The IUPAC name of cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile (CID 59970295) is cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile.
What is the SMILES notation for cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile?
The canonical SMILES for cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile is C[C@@H]1C[C@H](C)CC(C)(C#N)C1.
What is the InChIKey of cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile?
The InChIKey is BCAWLBRCMYCQKC-ULKQDVFKSA-N. The full InChI is InChI=1S/C10H17N/c1-8-4-9(2)6-10(3,5-8)7-11/h8-9H,4-6H2,1-3H3/t8-,9+,10?.
What are the key properties of cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile?
cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile has a molecular weight of 151.25 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3S,5R)-1,3,5-trimethylcyclohexane-1-carbonitrile is sourced from PubChem (CID 59970295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).