C10H15NO — CID 130541974
5,7-dimethyl-1-oxaspiro[2.5]octane-2-carbonitrile (PubChem CID 130541974) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 5,7-dimethyl-1-oxaspiro[2.5]octane-2-carbonitrile.
| Compound Name | 5,7-dimethyl-1-oxaspiro[2.5]octane-2-carbonitrile |
|---|---|
| PubChem CID | 130541974 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5,7-dimethyl-1-oxaspiro[2.5]octane-2-carbonitrile |
| SMILES | CC1CC(C)CC2(C1)OC2C#N |
| InChI | InChI=1S/C10H15NO/c1-7-3-8(2)5-10(4-7)9(6-11)12-10/h7-9H,3-5H2,1-2H3 |
| InChIKey | IGBHMCIIZZANFI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|