C9H13NO2 — CID 130542002
5,7-dimethyl-1,6-dioxaspiro[2.5]octane-2-carbonitrile (PubChem CID 130542002) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 5,7-dimethyl-1,6-dioxaspiro[2.5]octane-2-carbonitrile.
| Compound Name | 5,7-dimethyl-1,6-dioxaspiro[2.5]octane-2-carbonitrile |
|---|---|
| PubChem CID | 130542002 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 5,7-dimethyl-1,6-dioxaspiro[2.5]octane-2-carbonitrile |
| SMILES | CC1CC2(CC(C)O1)OC2C#N |
| InChI | InChI=1S/C9H13NO2/c1-6-3-9(4-7(2)11-6)8(5-10)12-9/h6-8H,3-4H2,1-2H3 |
| InChIKey | XJKSZVZWJFDDPY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|