C11H19IO2 — CID 130582587
2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane (PubChem CID 130582587) has the molecular formula C11H19IO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane.
| Compound Name | 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 130582587 |
| Molecular Formula | C11H19IO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane |
| SMILES | CC1CC2(CCC(CI)O2)CC(C)O1 |
| InChI | InChI=1S/C11H19IO2/c1-8-5-11(6-9(2)13-8)4-3-10(7-12)14-11/h8-10H,3-7H2,1-2H3 |
| InChIKey | HFMWAATWFNGSRX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|