About 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane
2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane (PubChem CID 130582587) has the molecular formula C11H19IO2
and a molecular weight of 310.18 g/mol. Its IUPAC name is 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane |
| PubChem CID | 130582587 |
| Molecular Formula | C11H19IO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane |
| SMILES | CC1CC2(CCC(CI)O2)CC(C)O1 |
| InChI | InChI=1S/C11H19IO2/c1-8-5-11(6-9(2)13-8)4-3-10(7-12)14-11/h8-10H,3-7H2,1-2H3 |
| InChIKey | HFMWAATWFNGSRX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane?
The IUPAC name of 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane (CID 130582587) is 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane.
What is the SMILES notation for 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane?
The canonical SMILES for 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane is CC1CC2(CCC(CI)O2)CC(C)O1.
What is the InChIKey of 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane?
The InChIKey is HFMWAATWFNGSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19IO2/c1-8-5-11(6-9(2)13-8)4-3-10(7-12)14-11/h8-10H,3-7H2,1-2H3.
What are the key properties of 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane?
2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane has a molecular weight of 310.18 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodomethyl)-7,9-dimethyl-1,8-dioxaspiro[4.5]decane is sourced from PubChem (CID 130582587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).