C7H12O2 — CID 177019772
2-methyl-1,7-dioxaspiro[3.4]octane (PubChem CID 177019772) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-methyl-1,7-dioxaspiro[3.4]octane.
| Compound Name | 2-methyl-1,7-dioxaspiro[3.4]octane |
|---|---|
| PubChem CID | 177019772 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2-methyl-1,7-dioxaspiro[3.4]octane |
| SMILES | CC1CC2(CCOC2)O1 |
| InChI | InChI=1S/C7H12O2/c1-6-4-7(9-6)2-3-8-5-7/h6H,2-5H2,1H3 |
| InChIKey | YJENGEARVTVSFO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |