C10H18O2 — CID 131067264
4-methyl-1,9-dioxaspiro[5.5]undecane (PubChem CID 131067264) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 4-methyl-1,9-dioxaspiro[5.5]undecane.
| Compound Name | 4-methyl-1,9-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 131067264 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 4-methyl-1,9-dioxaspiro[5.5]undecane |
| SMILES | CC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C10H18O2/c1-9-2-5-12-10(8-9)3-6-11-7-4-10/h9H,2-8H2,1H3 |
| InChIKey | WPXZMWJTAXVTCR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |