C9H15IO2 — CID 79923455
4-iodo-1,9-dioxaspiro[5.5]undecane (PubChem CID 79923455) has the molecular formula C9H15IO2 and a molecular weight of 282.12 g/mol. Its IUPAC name is 4-iodo-1,9-dioxaspiro[5.5]undecane.
| Compound Name | 4-iodo-1,9-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79923455 |
| Molecular Formula | C9H15IO2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 4-iodo-1,9-dioxaspiro[5.5]undecane |
| SMILES | IC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C9H15IO2/c10-8-1-4-12-9(7-8)2-5-11-6-3-9/h8H,1-7H2 |
| InChIKey | OBRJKSKMGPBNLL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|