C9H17NO3 — CID 79894333
O-(1,9-dioxaspiro[5.5]undecan-4-yl)hydroxylamine (PubChem CID 79894333) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is O-(1,9-dioxaspiro[5.5]undecan-4-yl)hydroxylamine.
| Compound Name | O-(1,9-dioxaspiro[5.5]undecan-4-yl)hydroxylamine |
|---|---|
| PubChem CID | 79894333 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | O-(1,9-dioxaspiro[5.5]undecan-4-yl)hydroxylamine |
| SMILES | NOC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C9H17NO3/c10-13-8-1-4-12-9(7-8)2-5-11-6-3-9/h8H,1-7,10H2 |
| InChIKey | MYVHMDJKEAORJL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|